C9H11FN2O — CID 126987371
2-[(6-fluoro-2-pyridinyl)amino]but-3-en-1-ol (PubChem CID 126987371) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-[(6-fluoro-2-pyridinyl)amino]but-3-en-1-ol.
| Compound Name | 2-[(6-fluoro-2-pyridinyl)amino]but-3-en-1-ol |
|---|---|
| PubChem CID | 126987371 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-[(6-fluoro-2-pyridinyl)amino]but-3-en-1-ol |
| SMILES | C=CC(CO)Nc1cccc(F)n1 |
| InChI | InChI=1S/C9H11FN2O/c1-2-7(6-13)11-9-5-3-4-8(10)12-9/h2-5,7,13H,1,6H2,(H,11,12) |
| InChIKey | GFYXSDWYNXQGLQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|