About (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol
(2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol (PubChem CID 126988145) has the molecular formula C9H15ClN2OS
and a molecular weight of 234.75 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol |
| PubChem CID | 126988145 |
| Molecular Formula | C9H15ClN2OS |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)[C@@H](CO)Nc1ncc(Cl)s1 |
| InChI | InChI=1S/C9H15ClN2OS/c1-9(2,3)6(5-13)12-8-11-4-7(10)14-8/h4,6,13H,5H2,1-3H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | MGCKOIGXKUXWGF-ZCFIWIBFSA-N |
| XLogP | 2.62 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol?
The IUPAC name of (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol (CID 126988145) is (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol.
What is the SMILES notation for (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol?
The canonical SMILES for (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol is CC(C)(C)[C@@H](CO)Nc1ncc(Cl)s1.
What is the InChIKey of (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol?
The InChIKey is MGCKOIGXKUXWGF-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H15ClN2OS/c1-9(2,3)6(5-13)12-8-11-4-7(10)14-8/h4,6,13H,5H2,1-3H3,(H,11,12)/t6-/m1/s1.
What are the key properties of (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol?
(2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol has a molecular weight of 234.75 g/mol, XLogP of 2.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(5-chloro-1,3-thiazol-2-yl)amino]-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 126988145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).