About N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide
N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide (PubChem CID 126988272) has the molecular formula C7H11F3N2O
and a molecular weight of 196.17 g/mol. Its IUPAC name is N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide |
| PubChem CID | 126988272 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide |
| SMILES | CNC(=O)N1CC(CC(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3N2O/c1-11-6(13)12-3-5(4-12)2-7(8,9)10/h5H,2-4H2,1H3,(H,11,13) |
| InChIKey | DENONWMJEXPLSF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
The IUPAC name of N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide (CID 126988272) is N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide.
What is the SMILES notation for N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
The canonical SMILES for N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide is CNC(=O)N1CC(CC(F)(F)F)C1.
What is the InChIKey of N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
The InChIKey is DENONWMJEXPLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2O/c1-11-6(13)12-3-5(4-12)2-7(8,9)10/h5H,2-4H2,1H3,(H,11,13).
What are the key properties of N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide?
N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide has a molecular weight of 196.17 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(2,2,2-trifluoroethyl)azetidine-1-carboxamide is sourced from PubChem (CID 126988272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).