About 2-N,2-N-dimethylthiophene-2,5-dicarboxamide
2-N,2-N-dimethylthiophene-2,5-dicarboxamide (PubChem CID 126988322) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-N,2-N-dimethylthiophene-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,2-N-dimethylthiophene-2,5-dicarboxamide |
| PubChem CID | 126988322 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-N,2-N-dimethylthiophene-2,5-dicarboxamide |
| SMILES | CN(C)C(=O)c1ccc(C(N)=O)s1 |
| InChI | InChI=1S/C8H10N2O2S/c1-10(2)8(12)6-4-3-5(13-6)7(9)11/h3-4H,1-2H3,(H2,9,11) |
| InChIKey | NZNUKZYEXAUXPI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,2-N-dimethylthiophene-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethylthiophene-2,5-dicarboxamide?
The IUPAC name of 2-N,2-N-dimethylthiophene-2,5-dicarboxamide (CID 126988322) is 2-N,2-N-dimethylthiophene-2,5-dicarboxamide.
What is the SMILES notation for 2-N,2-N-dimethylthiophene-2,5-dicarboxamide?
The canonical SMILES for 2-N,2-N-dimethylthiophene-2,5-dicarboxamide is CN(C)C(=O)c1ccc(C(N)=O)s1.
What is the InChIKey of 2-N,2-N-dimethylthiophene-2,5-dicarboxamide?
The InChIKey is NZNUKZYEXAUXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c1-10(2)8(12)6-4-3-5(13-6)7(9)11/h3-4H,1-2H3,(H2,9,11).
What are the key properties of 2-N,2-N-dimethylthiophene-2,5-dicarboxamide?
2-N,2-N-dimethylthiophene-2,5-dicarboxamide has a molecular weight of 198.25 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethylthiophene-2,5-dicarboxamide is sourced from PubChem (CID 126988322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).