About 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride
1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride (PubChem CID 12698936) has the molecular formula C17H17ClN2O2
and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride |
| PubChem CID | 12698936 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride |
| SMILES | Cl.c1ccc2c(C3(Cn4ccnc4)OCCO3)cccc2c1 |
| InChI | InChI=1S/C17H16N2O2.ClH/c1-2-6-15-14(4-1)5-3-7-16(15)17(20-10-11-21-17)12-19-9-8-18-13-19;/h1-9,13H,10-12H2;1H |
| InChIKey | CPOSWSDBEXZYPN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride?
The IUPAC name of 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride (CID 12698936) is 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride.
What is the SMILES notation for 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride?
The canonical SMILES for 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride is Cl.c1ccc2c(C3(Cn4ccnc4)OCCO3)cccc2c1.
What is the InChIKey of 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride?
The InChIKey is CPOSWSDBEXZYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2.ClH/c1-2-6-15-14(4-1)5-3-7-16(15)17(20-10-11-21-17)12-19-9-8-18-13-19;/h1-9,13H,10-12H2;1H.
What are the key properties of 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride?
1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride has a molecular weight of 316.79 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-naphthalen-1-yl-1,3-dioxolan-2-yl)methyl]imidazole;hydrochloride is sourced from PubChem (CID 12698936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).