C9H12N2O2 — CID 126990678
1-but-2-ynoylpyrrolidine-2-carboxamide (PubChem CID 126990678) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-but-2-ynoylpyrrolidine-2-carboxamide.
| Compound Name | 1-but-2-ynoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126990678 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-but-2-ynoylpyrrolidine-2-carboxamide |
| SMILES | CC#CC(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C9H12N2O2/c1-2-4-8(12)11-6-3-5-7(11)9(10)13/h7H,3,5-6H2,1H3,(H2,10,13) |
| InChIKey | QEQLTPUAEDXSFN-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|