About 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole
5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole (PubChem CID 126990856) has the molecular formula C9H13ClN2S
and a molecular weight of 216.74 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole |
| PubChem CID | 126990856 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole |
| SMILES | CC1CCN(c2ncc(Cl)s2)C1C |
| InChI | InChI=1S/C9H13ClN2S/c1-6-3-4-12(7(6)2)9-11-5-8(10)13-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | LDCAUSYJOYSVOH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole?
The IUPAC name of 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole (CID 126990856) is 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole.
What is the SMILES notation for 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole?
The canonical SMILES for 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole is CC1CCN(c2ncc(Cl)s2)C1C.
What is the InChIKey of 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole?
The InChIKey is LDCAUSYJOYSVOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2S/c1-6-3-4-12(7(6)2)9-11-5-8(10)13-9/h5-7H,3-4H2,1-2H3.
What are the key properties of 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole?
5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole has a molecular weight of 216.74 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,3-dimethylpyrrolidin-1-yl)-1,3-thiazole is sourced from PubChem (CID 126990856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).