About 2-(3-methylbutyl)-1,2-oxazolidine
2-(3-methylbutyl)-1,2-oxazolidine (PubChem CID 126991187) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-(3-methylbutyl)-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-(3-methylbutyl)-1,2-oxazolidine |
| PubChem CID | 126991187 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-(3-methylbutyl)-1,2-oxazolidine |
| SMILES | CC(C)CCN1CCCO1 |
| InChI | InChI=1S/C8H17NO/c1-8(2)4-6-9-5-3-7-10-9/h8H,3-7H2,1-2H3 |
| InChIKey | HTXJSOCIMVVSJI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-methylbutyl)-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutyl)-1,2-oxazolidine?
The IUPAC name of 2-(3-methylbutyl)-1,2-oxazolidine (CID 126991187) is 2-(3-methylbutyl)-1,2-oxazolidine.
What is the SMILES notation for 2-(3-methylbutyl)-1,2-oxazolidine?
The canonical SMILES for 2-(3-methylbutyl)-1,2-oxazolidine is CC(C)CCN1CCCO1.
What is the InChIKey of 2-(3-methylbutyl)-1,2-oxazolidine?
The InChIKey is HTXJSOCIMVVSJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-8(2)4-6-9-5-3-7-10-9/h8H,3-7H2,1-2H3.
What are the key properties of 2-(3-methylbutyl)-1,2-oxazolidine?
2-(3-methylbutyl)-1,2-oxazolidine has a molecular weight of 143.23 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutyl)-1,2-oxazolidine is sourced from PubChem (CID 126991187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).