cyclobutyl 3,3-difluorocyclobutane-1-carboxylate

C9H12F2O2 — CID 126991531

IUPACcyclobutyl 3,3-difluorocyclobutane-1-carboxylate
SMILESO=C(OC1CCC1)C1CC(F)(F)C1
InChIInChI=1S/C9H12F2O2/c10-9(11)4-6(5-9)8(12)13-7-2-1-3-7/h6-7H,1-5H2
InChIKeyDPDWEGUJGRVVLA-UHFFFAOYSA-N
MW190.19 g/mol
LogP2.13
Rot. Bonds2

About cyclobutyl 3,3-difluorocyclobutane-1-carboxylate

cyclobutyl 3,3-difluorocyclobutane-1-carboxylate (PubChem CID 126991531) has the molecular formula C9H12F2O2 and a molecular weight of 190.19 g/mol. Its IUPAC name is cyclobutyl 3,3-difluorocyclobutane-1-carboxylate.

Molecular Properties

Compound Namecyclobutyl 3,3-difluorocyclobutane-1-carboxylate
PubChem CID126991531
Molecular FormulaC9H12F2O2
Molecular Weight190.19 g/mol
Exact Mass190.08
IUPAC Namecyclobutyl 3,3-difluorocyclobutane-1-carboxylate
SMILESO=C(OC1CCC1)C1CC(F)(F)C1
InChIInChI=1S/C9H12F2O2/c10-9(11)4-6(5-9)8(12)13-7-2-1-3-7/h6-7H,1-5H2
InChIKeyDPDWEGUJGRVVLA-UHFFFAOYSA-N
XLogP2.13
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.19
LogP ≤ 52.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze cyclobutyl 3,3-difluorocyclobutane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

cyclopentyl cyclopropanecarboxylate;ethane
CID 145397481
cyclobutyl 3-aminocyclopentane-1-carboxylate
CID 66031804
cyclooctyl cyclooctanecarboxylate
CID 57160377
cyclobutyl cyclopent-3-ene-1-carboxylate
CID 130979385
cyclopropyl cyclopropanecarboxylate
CID 54407874
[4-(cyclohexanecarbonyloxy)cyclohexyl] cyclohexanecarboxylate
CID 118132173
4-cyclopentyloxycarbonylcyclohexane-1-carboxylic acid
CID 154411856
propan-2-yl 3,3-difluorocyclobutane-1-carboxylate
CID 131200165
3,3-difluorocyclobutane-1-carbonyl chloride
CID 83855003
cyclobutyl carbonofluoridate
CID 126746202
4-cyclohexyloxycarbonylcyclohexane-1-carboxylic acid
CID 23444122
cyclopentyl 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-5-carboxylate
CID 25094738

Frequently Asked Questions

What is the IUPAC name of cyclobutyl 3,3-difluorocyclobutane-1-carboxylate?
The IUPAC name of cyclobutyl 3,3-difluorocyclobutane-1-carboxylate (CID 126991531) is cyclobutyl 3,3-difluorocyclobutane-1-carboxylate.
What is the SMILES notation for cyclobutyl 3,3-difluorocyclobutane-1-carboxylate?
The canonical SMILES for cyclobutyl 3,3-difluorocyclobutane-1-carboxylate is O=C(OC1CCC1)C1CC(F)(F)C1.
What is the InChIKey of cyclobutyl 3,3-difluorocyclobutane-1-carboxylate?
The InChIKey is DPDWEGUJGRVVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O2/c10-9(11)4-6(5-9)8(12)13-7-2-1-3-7/h6-7H,1-5H2.
What are the key properties of cyclobutyl 3,3-difluorocyclobutane-1-carboxylate?
cyclobutyl 3,3-difluorocyclobutane-1-carboxylate has a molecular weight of 190.19 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl 3,3-difluorocyclobutane-1-carboxylate is sourced from PubChem (CID 126991531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).