About trans-(1R,2S)-1-methylcyclobutane-1,2-diamine
trans-(1R,2S)-1-methylcyclobutane-1,2-diamine (PubChem CID 12699189) has the molecular formula C5H12N2
and a molecular weight of 100.17 g/mol. Its IUPAC name is trans-(1R,2S)-1-methylcyclobutane-1,2-diamine.
Molecular Properties
| Compound Name | trans-(1R,2S)-1-methylcyclobutane-1,2-diamine |
| PubChem CID | 12699189 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.17 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | trans-(1R,2S)-1-methylcyclobutane-1,2-diamine |
| SMILES | C[C@@]1(N)CC[C@@H]1N |
| InChI | InChI=1S/C5H12N2/c1-5(7)3-2-4(5)6/h4H,2-3,6-7H2,1H3/t4-,5+/m0/s1 |
| InChIKey | LALUZPHSSLKIMO-CRCLSJGQSA-N |
| XLogP | -0.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2S)-1-methylcyclobutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-1-methylcyclobutane-1,2-diamine?
The IUPAC name of trans-(1R,2S)-1-methylcyclobutane-1,2-diamine (CID 12699189) is trans-(1R,2S)-1-methylcyclobutane-1,2-diamine.
What is the SMILES notation for trans-(1R,2S)-1-methylcyclobutane-1,2-diamine?
The canonical SMILES for trans-(1R,2S)-1-methylcyclobutane-1,2-diamine is C[C@@]1(N)CC[C@@H]1N.
What is the InChIKey of trans-(1R,2S)-1-methylcyclobutane-1,2-diamine?
The InChIKey is LALUZPHSSLKIMO-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H12N2/c1-5(7)3-2-4(5)6/h4H,2-3,6-7H2,1H3/t4-,5+/m0/s1.
What are the key properties of trans-(1R,2S)-1-methylcyclobutane-1,2-diamine?
trans-(1R,2S)-1-methylcyclobutane-1,2-diamine has a molecular weight of 100.17 g/mol, XLogP of -0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-1-methylcyclobutane-1,2-diamine is sourced from PubChem (CID 12699189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).