About 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea
1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea (PubChem CID 126991906) has the molecular formula C7H8Cl2N2OS
and a molecular weight of 239.13 g/mol. Its IUPAC name is 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea |
| PubChem CID | 126991906 |
| Molecular Formula | C7H8Cl2N2OS |
| Molecular Weight | 239.13 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H8Cl2N2OS/c1-10-7(12)11-3-4-2-5(8)13-6(4)9/h2H,3H2,1H3,(H2,10,11,12) |
| InChIKey | CAZUXRJJOCITRS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea?
The IUPAC name of 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea (CID 126991906) is 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea.
What is the SMILES notation for 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea?
The canonical SMILES for 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea is CNC(=O)NCc1cc(Cl)sc1Cl.
What is the InChIKey of 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea?
The InChIKey is CAZUXRJJOCITRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N2OS/c1-10-7(12)11-3-4-2-5(8)13-6(4)9/h2H,3H2,1H3,(H2,10,11,12).
What are the key properties of 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea?
1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea has a molecular weight of 239.13 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-dichlorothiophen-3-yl)methyl]-3-methylurea is sourced from PubChem (CID 126991906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).