About 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine
1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine (PubChem CID 126992135) has the molecular formula C10H17F2N
and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine.
Molecular Properties
| Compound Name | 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine |
| PubChem CID | 126992135 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine |
| SMILES | C=CC(C)N1CCC(C)C(F)(F)C1 |
| InChI | InChI=1S/C10H17F2N/c1-4-9(3)13-6-5-8(2)10(11,12)7-13/h4,8-9H,1,5-7H2,2-3H3 |
| InChIKey | BKYAHFLGPBJSHI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine?
The IUPAC name of 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine (CID 126992135) is 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine.
What is the SMILES notation for 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine?
The canonical SMILES for 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine is C=CC(C)N1CCC(C)C(F)(F)C1.
What is the InChIKey of 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine?
The InChIKey is BKYAHFLGPBJSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N/c1-4-9(3)13-6-5-8(2)10(11,12)7-13/h4,8-9H,1,5-7H2,2-3H3.
What are the key properties of 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine?
1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine has a molecular weight of 189.25 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-en-2-yl-3,3-difluoro-4-methylpiperidine is sourced from PubChem (CID 126992135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).