About 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one
1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one (PubChem CID 126992781) has the molecular formula C7H4Br2F2OS
and a molecular weight of 333.98 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one.
Molecular Properties
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one |
| PubChem CID | 126992781 |
| Molecular Formula | C7H4Br2F2OS |
| Molecular Weight | 333.98 g/mol |
| Exact Mass | 331.83 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one |
| SMILES | CC(F)(F)C(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C7H4Br2F2OS/c1-7(10,11)5(12)3-2-4(8)13-6(3)9/h2H,1H3 |
| InChIKey | JTTDMTFDIBTLMO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.98 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one?
The IUPAC name of 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one (CID 126992781) is 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one.
What is the SMILES notation for 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one?
The canonical SMILES for 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one is CC(F)(F)C(=O)c1cc(Br)sc1Br.
What is the InChIKey of 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one?
The InChIKey is JTTDMTFDIBTLMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2F2OS/c1-7(10,11)5(12)3-2-4(8)13-6(3)9/h2H,1H3.
What are the key properties of 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one?
1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one has a molecular weight of 333.98 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-one is sourced from PubChem (CID 126992781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).