About ethyl 2,3-dihydroxypropanoate
ethyl 2,3-dihydroxypropanoate (PubChem CID 12699281) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is ethyl 2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | ethyl 2,3-dihydroxypropanoate |
| PubChem CID | 12699281 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | ethyl 2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)CO |
| InChI | InChI=1S/C5H10O4/c1-2-9-5(8)4(7)3-6/h4,6-7H,2-3H2,1H3 |
| InChIKey | FTOZMXOHOKRHNL-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dihydroxypropanoate?
The IUPAC name of ethyl 2,3-dihydroxypropanoate (CID 12699281) is ethyl 2,3-dihydroxypropanoate.
What is the SMILES notation for ethyl 2,3-dihydroxypropanoate?
The canonical SMILES for ethyl 2,3-dihydroxypropanoate is CCOC(=O)C(O)CO.
What is the InChIKey of ethyl 2,3-dihydroxypropanoate?
The InChIKey is FTOZMXOHOKRHNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4/c1-2-9-5(8)4(7)3-6/h4,6-7H,2-3H2,1H3.
What are the key properties of ethyl 2,3-dihydroxypropanoate?
ethyl 2,3-dihydroxypropanoate has a molecular weight of 134.13 g/mol, XLogP of -1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydroxypropanoate is sourced from PubChem (CID 12699281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).