About 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine
1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine (PubChem CID 126993548) has the molecular formula C9H12Cl2FN
and a molecular weight of 224.11 g/mol. Its IUPAC name is 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine |
| PubChem CID | 126993548 |
| Molecular Formula | C9H12Cl2FN |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine |
| SMILES | FC1=CCCN(CC2CC2(Cl)Cl)C1 |
| InChI | InChI=1S/C9H12Cl2FN/c10-9(11)4-7(9)5-13-3-1-2-8(12)6-13/h2,7H,1,3-6H2 |
| InChIKey | MHLPDCUWCIRMPX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine (CID 126993548) is 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine is FC1=CCCN(CC2CC2(Cl)Cl)C1.
What is the InChIKey of 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine?
The InChIKey is MHLPDCUWCIRMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2FN/c10-9(11)4-7(9)5-13-3-1-2-8(12)6-13/h2,7H,1,3-6H2.
What are the key properties of 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine?
1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine has a molecular weight of 224.11 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-dichlorocyclopropyl)methyl]-5-fluoro-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 126993548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).