C6H12F2S — CID 126994381
1-(2,2-difluoroethylsulfanyl)-2-methylpropane (PubChem CID 126994381) has the molecular formula C6H12F2S and a molecular weight of 154.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethylsulfanyl)-2-methylpropane.
| Compound Name | 1-(2,2-difluoroethylsulfanyl)-2-methylpropane |
|---|---|
| PubChem CID | 126994381 |
| Molecular Formula | C6H12F2S |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-(2,2-difluoroethylsulfanyl)-2-methylpropane |
| SMILES | CC(C)CSCC(F)F |
| InChI | InChI=1S/C6H12F2S/c1-5(2)3-9-4-6(7)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | BTYNTNNWSYQNKE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |