C8H13F2N — CID 126994799
1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine (PubChem CID 126994799) has the molecular formula C8H13F2N and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 126994799 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C8H13F2N/c1-7-2-4-11(5-3-7)6-8(9)10/h2,8H,3-6H2,1H3 |
| InChIKey | SSPKLZYKNILQHQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|