About 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol
4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol (PubChem CID 126995503) has the molecular formula C7H11ClN2OS
and a molecular weight of 206.70 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol.
Molecular Properties
| Compound Name | 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol |
| PubChem CID | 126995503 |
| Molecular Formula | C7H11ClN2OS |
| Molecular Weight | 206.70 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol |
| SMILES | CC(O)CCNc1ncc(Cl)s1 |
| InChI | InChI=1S/C7H11ClN2OS/c1-5(11)2-3-9-7-10-4-6(8)12-7/h4-5,11H,2-3H2,1H3,(H,9,10) |
| InChIKey | QZUBSIGREAFIGM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol?
The IUPAC name of 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol (CID 126995503) is 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol.
What is the SMILES notation for 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol?
The canonical SMILES for 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol is CC(O)CCNc1ncc(Cl)s1.
What is the InChIKey of 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol?
The InChIKey is QZUBSIGREAFIGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2OS/c1-5(11)2-3-9-7-10-4-6(8)12-7/h4-5,11H,2-3H2,1H3,(H,9,10).
What are the key properties of 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol?
4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol has a molecular weight of 206.70 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-1,3-thiazol-2-yl)amino]butan-2-ol is sourced from PubChem (CID 126995503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).