About 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide
2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide (PubChem CID 126995643) has the molecular formula C7H10BrF2NO
and a molecular weight of 242.06 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide.
Molecular Properties
| Compound Name | 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide |
| PubChem CID | 126995643 |
| Molecular Formula | C7H10BrF2NO |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide |
| SMILES | CC1CC(NC(=O)C(F)(F)Br)C1 |
| InChI | InChI=1S/C7H10BrF2NO/c1-4-2-5(3-4)11-6(12)7(8,9)10/h4-5H,2-3H2,1H3,(H,11,12) |
| InChIKey | JNOLOBXTWMYAES-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide?
The IUPAC name of 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide (CID 126995643) is 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide.
What is the SMILES notation for 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide?
The canonical SMILES for 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide is CC1CC(NC(=O)C(F)(F)Br)C1.
What is the InChIKey of 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide?
The InChIKey is JNOLOBXTWMYAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrF2NO/c1-4-2-5(3-4)11-6(12)7(8,9)10/h4-5H,2-3H2,1H3,(H,11,12).
What are the key properties of 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide?
2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide has a molecular weight of 242.06 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2,2-difluoro-N-(3-methylcyclobutyl)acetamide is sourced from PubChem (CID 126995643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).