C8H13N3O — CID 126996007
(E)-1-(1,5-dimethylpyrazol-4-yl)-N-ethoxymethanimine (PubChem CID 126996007) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (E)-1-(1,5-dimethylpyrazol-4-yl)-N-ethoxymethanimine.
| Compound Name | (E)-1-(1,5-dimethylpyrazol-4-yl)-N-ethoxymethanimine |
|---|---|
| PubChem CID | 126996007 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (E)-1-(1,5-dimethylpyrazol-4-yl)-N-ethoxymethanimine |
| SMILES | CCO/N=C/c1cnn(C)c1C |
| InChI | InChI=1S/C8H13N3O/c1-4-12-10-6-8-5-9-11(3)7(8)2/h5-6H,4H2,1-3H3/b10-6+ |
| InChIKey | JUKXWZNFDIXHSV-UXBLZVDNSA-N |
| XLogP | 1.10 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|