C9H10N2O — CID 126996184
5,6-dimethyl-3-prop-2-ynylpyrimidin-4-one (PubChem CID 126996184) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5,6-dimethyl-3-prop-2-ynylpyrimidin-4-one.
| Compound Name | 5,6-dimethyl-3-prop-2-ynylpyrimidin-4-one |
|---|---|
| PubChem CID | 126996184 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5,6-dimethyl-3-prop-2-ynylpyrimidin-4-one |
| SMILES | C#CCn1cnc(C)c(C)c1=O |
| InChI | InChI=1S/C9H10N2O/c1-4-5-11-6-10-8(3)7(2)9(11)12/h1,6H,5H2,2-3H3 |
| InChIKey | UJDRIPAODUQONH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|