C5H5F2N3OS — CID 126996511
N-(2,2-difluoroethyl)thiadiazole-4-carboxamide (PubChem CID 126996511) has the molecular formula C5H5F2N3OS and a molecular weight of 193.18 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)thiadiazole-4-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 126996511 |
| Molecular Formula | C5H5F2N3OS |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | N-(2,2-difluoroethyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NCC(F)F)c1csnn1 |
| InChI | InChI=1S/C5H5F2N3OS/c6-4(7)1-8-5(11)3-2-12-10-9-3/h2,4H,1H2,(H,8,11) |
| InChIKey | JQLRPSKPDJWAHY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |