C10H16N2 — CID 126996535
1,5,6-trimethyl-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 126996535) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1,5,6-trimethyl-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 1,5,6-trimethyl-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 126996535 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1,5,6-trimethyl-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | CC1Cc2ncn(C)c2CC1C |
| InChI | InChI=1S/C10H16N2/c1-7-4-9-10(5-8(7)2)12(3)6-11-9/h6-8H,4-5H2,1-3H3 |
| InChIKey | MFNUGCULTNXYQF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |