About 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine
1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine (PubChem CID 126997126) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine |
| PubChem CID | 126997126 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine |
| SMILES | NC1(C2=NCCN2)CCCC1 |
| InChI | InChI=1S/C8H15N3/c9-8(3-1-2-4-8)7-10-5-6-11-7/h1-6,9H2,(H,10,11) |
| InChIKey | YOGSUKJLBRLPNR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine (CID 126997126) is 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine is NC1(C2=NCCN2)CCCC1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine?
The InChIKey is YOGSUKJLBRLPNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c9-8(3-1-2-4-8)7-10-5-6-11-7/h1-6,9H2,(H,10,11).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine?
1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine has a molecular weight of 153.23 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)cyclopentan-1-amine is sourced from PubChem (CID 126997126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).