About 3-methyl-1,3-thiazol-3-ium-2-amine
3-methyl-1,3-thiazol-3-ium-2-amine (PubChem CID 1269974) has the molecular formula C4H7N2S+
and a molecular weight of 115.18 g/mol. Its IUPAC name is 3-methyl-1,3-thiazol-3-ium-2-amine.
Molecular Properties
| Compound Name | 3-methyl-1,3-thiazol-3-ium-2-amine |
| PubChem CID | 1269974 |
| Molecular Formula | C4H7N2S+ |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 3-methyl-1,3-thiazol-3-ium-2-amine |
| SMILES | C[n+]1ccsc1N |
| InChI | InChI=1S/C4H6N2S/c1-6-2-3-7-4(6)5/h2-3,5H,1H3/p+1 |
| InChIKey | YGUHKHFHVUKJQH-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,3-thiazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,3-thiazol-3-ium-2-amine?
The IUPAC name of 3-methyl-1,3-thiazol-3-ium-2-amine (CID 1269974) is 3-methyl-1,3-thiazol-3-ium-2-amine.
What is the SMILES notation for 3-methyl-1,3-thiazol-3-ium-2-amine?
The canonical SMILES for 3-methyl-1,3-thiazol-3-ium-2-amine is C[n+]1ccsc1N.
What is the InChIKey of 3-methyl-1,3-thiazol-3-ium-2-amine?
The InChIKey is YGUHKHFHVUKJQH-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H6N2S/c1-6-2-3-7-4(6)5/h2-3,5H,1H3/p+1.
What are the key properties of 3-methyl-1,3-thiazol-3-ium-2-amine?
3-methyl-1,3-thiazol-3-ium-2-amine has a molecular weight of 115.18 g/mol, XLogP of 0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,3-thiazol-3-ium-2-amine is sourced from PubChem (CID 1269974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).