About 1-cyclobutyl-2,4-dimethylpyrrolidine
1-cyclobutyl-2,4-dimethylpyrrolidine (PubChem CID 126997653) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 1-cyclobutyl-2,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-cyclobutyl-2,4-dimethylpyrrolidine |
| PubChem CID | 126997653 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 1-cyclobutyl-2,4-dimethylpyrrolidine |
| SMILES | CC1CC(C)N(C2CCC2)C1 |
| InChI | InChI=1S/C10H19N/c1-8-6-9(2)11(7-8)10-4-3-5-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | UJWOBMCWCITFJA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclobutyl-2,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-2,4-dimethylpyrrolidine?
The IUPAC name of 1-cyclobutyl-2,4-dimethylpyrrolidine (CID 126997653) is 1-cyclobutyl-2,4-dimethylpyrrolidine.
What is the SMILES notation for 1-cyclobutyl-2,4-dimethylpyrrolidine?
The canonical SMILES for 1-cyclobutyl-2,4-dimethylpyrrolidine is CC1CC(C)N(C2CCC2)C1.
What is the InChIKey of 1-cyclobutyl-2,4-dimethylpyrrolidine?
The InChIKey is UJWOBMCWCITFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-8-6-9(2)11(7-8)10-4-3-5-10/h8-10H,3-7H2,1-2H3.
What are the key properties of 1-cyclobutyl-2,4-dimethylpyrrolidine?
1-cyclobutyl-2,4-dimethylpyrrolidine has a molecular weight of 153.27 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-2,4-dimethylpyrrolidine is sourced from PubChem (CID 126997653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).