C10H19N — CID 126997653
1-cyclobutyl-2,4-dimethylpyrrolidine (PubChem CID 126997653) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 1-cyclobutyl-2,4-dimethylpyrrolidine.
| Compound Name | 1-cyclobutyl-2,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 126997653 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 1-cyclobutyl-2,4-dimethylpyrrolidine |
| SMILES | CC1CC(C)N(C2CCC2)C1 |
| InChI | InChI=1S/C10H19N/c1-8-6-9(2)11(7-8)10-4-3-5-10/h8-10H,3-7H2,1-2H3 |
| InChIKey | UJWOBMCWCITFJA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |