About N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine
N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 126997747) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine |
| PubChem CID | 126997747 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1occc1CNc1ncns1 |
| InChI | InChI=1S/C8H9N3OS/c1-6-7(2-3-12-6)4-9-8-10-5-11-13-8/h2-3,5H,4H2,1H3,(H,9,10,11) |
| InChIKey | OMIFDUNAEIYNEC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine (CID 126997747) is N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine is Cc1occc1CNc1ncns1.
What is the InChIKey of N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine?
The InChIKey is OMIFDUNAEIYNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-6-7(2-3-12-6)4-9-8-10-5-11-13-8/h2-3,5H,4H2,1H3,(H,9,10,11).
What are the key properties of N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine?
N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine has a molecular weight of 195.25 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methylfuran-3-yl)methyl]-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 126997747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).