C8H14N2OS — CID 126999942
3-(3-methoxy-1,2-thiazol-5-yl)butan-2-amine (PubChem CID 126999942) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 3-(3-methoxy-1,2-thiazol-5-yl)butan-2-amine.
| Compound Name | 3-(3-methoxy-1,2-thiazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 126999942 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-(3-methoxy-1,2-thiazol-5-yl)butan-2-amine |
| SMILES | COc1cc(C(C)C(C)N)sn1 |
| InChI | InChI=1S/C8H14N2OS/c1-5(6(2)9)7-4-8(11-3)10-12-7/h4-6H,9H2,1-3H3 |
| InChIKey | VDCUUNBGPIYBJQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |