About [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine
[3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine (PubChem CID 126999962) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine |
| PubChem CID | 126999962 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine |
| SMILES | COc1cc(-c2ccoc2CN)sn1 |
| InChI | InChI=1S/C9H10N2O2S/c1-12-9-4-8(14-11-9)6-2-3-13-7(6)5-10/h2-4H,5,10H2,1H3 |
| InChIKey | BFYPCCWOZAMBLS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine?
The IUPAC name of [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine (CID 126999962) is [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine.
What is the SMILES notation for [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine?
The canonical SMILES for [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine is COc1cc(-c2ccoc2CN)sn1.
What is the InChIKey of [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine?
The InChIKey is BFYPCCWOZAMBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-12-9-4-8(14-11-9)6-2-3-13-7(6)5-10/h2-4H,5,10H2,1H3.
What are the key properties of [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine?
[3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine has a molecular weight of 210.26 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-methoxy-1,2-thiazol-5-yl)furan-2-yl]methanamine is sourced from PubChem (CID 126999962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).