About 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol
1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol (PubChem CID 126999965) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol |
| PubChem CID | 126999965 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol |
| SMILES | COc1cc(C(O)C(C)O)sn1 |
| InChI | InChI=1S/C7H11NO3S/c1-4(9)7(10)5-3-6(11-2)8-12-5/h3-4,7,9-10H,1-2H3 |
| InChIKey | QBSYFVCBIPYAFI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol?
The IUPAC name of 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol (CID 126999965) is 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol.
What is the SMILES notation for 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol?
The canonical SMILES for 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol is COc1cc(C(O)C(C)O)sn1.
What is the InChIKey of 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol?
The InChIKey is QBSYFVCBIPYAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-4(9)7(10)5-3-6(11-2)8-12-5/h3-4,7,9-10H,1-2H3.
What are the key properties of 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol?
1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol has a molecular weight of 189.24 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxy-1,2-thiazol-5-yl)propane-1,2-diol is sourced from PubChem (CID 126999965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).