About 3-butoxyphthalic acid
3-butoxyphthalic acid (PubChem CID 12699998) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-butoxyphthalic acid.
Molecular Properties
| Compound Name | 3-butoxyphthalic acid |
| PubChem CID | 12699998 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-butoxyphthalic acid |
| SMILES | CCCCOc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C12H14O5/c1-2-3-7-17-9-6-4-5-8(11(13)14)10(9)12(15)16/h4-6H,2-3,7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | QPFBMSRTTJUMHT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxyphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxyphthalic acid?
The IUPAC name of 3-butoxyphthalic acid (CID 12699998) is 3-butoxyphthalic acid.
What is the SMILES notation for 3-butoxyphthalic acid?
The canonical SMILES for 3-butoxyphthalic acid is CCCCOc1cccc(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-butoxyphthalic acid?
The InChIKey is QPFBMSRTTJUMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-2-3-7-17-9-6-4-5-8(11(13)14)10(9)12(15)16/h4-6H,2-3,7H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 3-butoxyphthalic acid?
3-butoxyphthalic acid has a molecular weight of 238.24 g/mol, XLogP of 2.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxyphthalic acid is sourced from PubChem (CID 12699998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).