About (3R,4R)-1,1-dioxothiolane-3,4-diol
(3R,4R)-1,1-dioxothiolane-3,4-diol (PubChem CID 1270001) has the molecular formula C4H8O4S
and a molecular weight of 152.17 g/mol. Its IUPAC name is (3R,4R)-1,1-dioxothiolane-3,4-diol.
Molecular Properties
| Compound Name | (3R,4R)-1,1-dioxothiolane-3,4-diol |
| PubChem CID | 1270001 |
| Molecular Formula | C4H8O4S |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.01 |
| IUPAC Name | (3R,4R)-1,1-dioxothiolane-3,4-diol |
| SMILES | O=S1(=O)C[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C4H8O4S/c5-3-1-9(7,8)2-4(3)6/h3-6H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | LDVDYVUZEKIBDP-IMJSIDKUSA-N |
| XLogP | -1.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-1,1-dioxothiolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-1,1-dioxothiolane-3,4-diol?
The IUPAC name of (3R,4R)-1,1-dioxothiolane-3,4-diol (CID 1270001) is (3R,4R)-1,1-dioxothiolane-3,4-diol.
What is the SMILES notation for (3R,4R)-1,1-dioxothiolane-3,4-diol?
The canonical SMILES for (3R,4R)-1,1-dioxothiolane-3,4-diol is O=S1(=O)C[C@H](O)[C@@H](O)C1.
What is the InChIKey of (3R,4R)-1,1-dioxothiolane-3,4-diol?
The InChIKey is LDVDYVUZEKIBDP-IMJSIDKUSA-N. The full InChI is InChI=1S/C4H8O4S/c5-3-1-9(7,8)2-4(3)6/h3-6H,1-2H2/t3-,4-/m0/s1.
What are the key properties of (3R,4R)-1,1-dioxothiolane-3,4-diol?
(3R,4R)-1,1-dioxothiolane-3,4-diol has a molecular weight of 152.17 g/mol, XLogP of -1.86, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-1,1-dioxothiolane-3,4-diol is sourced from PubChem (CID 1270001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).