C7H10N2O2S — CID 127000407
2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one (PubChem CID 127000407) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one.
| Compound Name | 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 127000407 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one |
| SMILES | COc1cc(C(=O)C(C)N)sn1 |
| InChI | InChI=1S/C7H10N2O2S/c1-4(8)7(10)5-3-6(11-2)9-12-5/h3-4H,8H2,1-2H3 |
| InChIKey | NQHWWBSSXLFGFB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |