About 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one
2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one (PubChem CID 127000407) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one |
| PubChem CID | 127000407 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one |
| SMILES | COc1cc(C(=O)C(C)N)sn1 |
| InChI | InChI=1S/C7H10N2O2S/c1-4(8)7(10)5-3-6(11-2)9-12-5/h3-4H,8H2,1-2H3 |
| InChIKey | NQHWWBSSXLFGFB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one?
The IUPAC name of 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one (CID 127000407) is 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one.
What is the SMILES notation for 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one?
The canonical SMILES for 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one is COc1cc(C(=O)C(C)N)sn1.
What is the InChIKey of 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one?
The InChIKey is NQHWWBSSXLFGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4(8)7(10)5-3-6(11-2)9-12-5/h3-4H,8H2,1-2H3.
What are the key properties of 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one?
2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one has a molecular weight of 186.24 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(3-methoxy-1,2-thiazol-5-yl)propan-1-one is sourced from PubChem (CID 127000407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).