About [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine
[cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 127002569) has the molecular formula C9H15N3S
and a molecular weight of 197.31 g/mol. Its IUPAC name is [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine |
| PubChem CID | 127002569 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsn1)C1CCCC1 |
| InChI | InChI=1S/C9H15N3S/c10-11-9(7-3-1-2-4-7)8-5-6-13-12-8/h5-7,9,11H,1-4,10H2 |
| InChIKey | LRLUFXOGNONSMF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine?
The IUPAC name of [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine (CID 127002569) is [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine.
What is the SMILES notation for [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine?
The canonical SMILES for [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine is NNC(c1ccsn1)C1CCCC1.
What is the InChIKey of [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine?
The InChIKey is LRLUFXOGNONSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3S/c10-11-9(7-3-1-2-4-7)8-5-6-13-12-8/h5-7,9,11H,1-4,10H2.
What are the key properties of [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine?
[cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine has a molecular weight of 197.31 g/mol, XLogP of 1.84, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclopentyl(1,2-thiazol-3-yl)methyl]hydrazine is sourced from PubChem (CID 127002569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).