C10H15NOS — CID 127002581
1-(3-methyl-1,2-thiazol-5-yl)cyclohexan-1-ol (PubChem CID 127002581) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 1-(3-methyl-1,2-thiazol-5-yl)cyclohexan-1-ol.
| Compound Name | 1-(3-methyl-1,2-thiazol-5-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 127002581 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 1-(3-methyl-1,2-thiazol-5-yl)cyclohexan-1-ol |
| SMILES | Cc1cc(C2(O)CCCCC2)sn1 |
| InChI | InChI=1S/C10H15NOS/c1-8-7-9(13-11-8)10(12)5-3-2-4-6-10/h7,12H,2-6H2,1H3 |
| InChIKey | AEMCBXVIYDDGID-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |