About (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine
(3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine (PubChem CID 127002585) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine |
| PubChem CID | 127002585 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine |
| SMILES | Cc1cc(C(N)c2cn[nH]n2)sn1 |
| InChI | InChI=1S/C7H9N5S/c1-4-2-6(13-11-4)7(8)5-3-9-12-10-5/h2-3,7H,8H2,1H3,(H,9,10,12) |
| InChIKey | ZXENIRWEXQMZHL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine?
The IUPAC name of (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine (CID 127002585) is (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine.
What is the SMILES notation for (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine?
The canonical SMILES for (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine is Cc1cc(C(N)c2cn[nH]n2)sn1.
What is the InChIKey of (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine?
The InChIKey is ZXENIRWEXQMZHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5S/c1-4-2-6(13-11-4)7(8)5-3-9-12-10-5/h2-3,7H,8H2,1H3,(H,9,10,12).
What are the key properties of (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine?
(3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine has a molecular weight of 195.25 g/mol, XLogP of 0.62, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-thiazol-5-yl)-(2H-triazol-4-yl)methanamine is sourced from PubChem (CID 127002585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).