About (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene
(E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene (PubChem CID 12700312) has the molecular formula C6H11BrO2
and a molecular weight of 195.06 g/mol. Its IUPAC name is (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene.
Molecular Properties
| Compound Name | (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene |
| PubChem CID | 12700312 |
| Molecular Formula | C6H11BrO2 |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene |
| SMILES | COC(OC)/C(C)=C/Br |
| InChI | InChI=1S/C6H11BrO2/c1-5(4-7)6(8-2)9-3/h4,6H,1-3H3/b5-4+ |
| InChIKey | GAXWKKAHUHNUKT-SNAWJCMRSA-N |
| XLogP | 1.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene?
The IUPAC name of (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene (CID 12700312) is (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene.
What is the SMILES notation for (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene?
The canonical SMILES for (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene is COC(OC)/C(C)=C/Br.
What is the InChIKey of (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene?
The InChIKey is GAXWKKAHUHNUKT-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H11BrO2/c1-5(4-7)6(8-2)9-3/h4,6H,1-3H3/b5-4+.
What are the key properties of (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene?
(E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene has a molecular weight of 195.06 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-bromo-3,3-dimethoxy-2-methylprop-1-ene is sourced from PubChem (CID 12700312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).