C22H22N3O2P — CID 12700397
2-methyl-3,3-bis(4-methylphenoxy)-5-phenyl-1,2,4-triaza-3λ5-phosphacyclopenta-3,5-diene (PubChem CID 12700397) has the molecular formula C22H22N3O2P and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-methyl-3,3-bis(4-methylphenoxy)-5-phenyl-1,2,4-triaza-3λ5-phosphacyclopenta-3,5-diene.
| Compound Name | 2-methyl-3,3-bis(4-methylphenoxy)-5-phenyl-1,2,4-triaza-3λ5-phosphacyclopenta-3,5-diene |
|---|---|
| PubChem CID | 12700397 |
| Molecular Formula | C22H22N3O2P |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-methyl-3,3-bis(4-methylphenoxy)-5-phenyl-1,2,4-triaza-3λ5-phosphacyclopenta-3,5-diene |
| SMILES | Cc1ccc(OP2(Oc3ccc(C)cc3)=NC(c3ccccc3)=NN2C)cc1 |
| InChI | InChI=1S/C22H22N3O2P/c1-17-9-13-20(14-10-17)26-28(27-21-15-11-18(2)12-16-21)24-22(23-25(28)3)19-7-5-4-6-8-19/h4-16H,1-3H3 |
| InChIKey | XEIDULDOKBZYPS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|