C7H12N4O2S — CID 127004647
(2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol (PubChem CID 127004647) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 127004647 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol |
| SMILES | Cn1nnc(C(O)C2CSCCO2)n1 |
| InChI | InChI=1S/C7H12N4O2S/c1-11-9-7(8-10-11)6(12)5-4-14-3-2-13-5/h5-6,12H,2-4H2,1H3 |
| InChIKey | ZCESGTMSRLKOGO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |