About (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol
(2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol (PubChem CID 127004647) has the molecular formula C7H12N4O2S
and a molecular weight of 216.27 g/mol. Its IUPAC name is (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol.
Molecular Properties
| Compound Name | (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol |
| PubChem CID | 127004647 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol |
| SMILES | Cn1nnc(C(O)C2CSCCO2)n1 |
| InChI | InChI=1S/C7H12N4O2S/c1-11-9-7(8-10-11)6(12)5-4-14-3-2-13-5/h5-6,12H,2-4H2,1H3 |
| InChIKey | ZCESGTMSRLKOGO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol?
The IUPAC name of (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol (CID 127004647) is (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol.
What is the SMILES notation for (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol?
The canonical SMILES for (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol is Cn1nnc(C(O)C2CSCCO2)n1.
What is the InChIKey of (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol?
The InChIKey is ZCESGTMSRLKOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2S/c1-11-9-7(8-10-11)6(12)5-4-14-3-2-13-5/h5-6,12H,2-4H2,1H3.
What are the key properties of (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol?
(2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol has a molecular weight of 216.27 g/mol, XLogP of -0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyltetrazol-5-yl)-(1,4-oxathian-2-yl)methanol is sourced from PubChem (CID 127004647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).