About 2-fluoro-1-methoxybutane
2-fluoro-1-methoxybutane (PubChem CID 12700781) has the molecular formula C5H11FO
and a molecular weight of 106.14 g/mol. Its IUPAC name is 2-fluoro-1-methoxybutane.
Molecular Properties
| Compound Name | 2-fluoro-1-methoxybutane |
| PubChem CID | 12700781 |
| Molecular Formula | C5H11FO |
| Molecular Weight | 106.14 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | 2-fluoro-1-methoxybutane |
| SMILES | CCC(F)COC |
| InChI | InChI=1S/C5H11FO/c1-3-5(6)4-7-2/h5H,3-4H2,1-2H3 |
| InChIKey | WZQVIHSKEKBWSC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-1-methoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-methoxybutane?
The IUPAC name of 2-fluoro-1-methoxybutane (CID 12700781) is 2-fluoro-1-methoxybutane.
What is the SMILES notation for 2-fluoro-1-methoxybutane?
The canonical SMILES for 2-fluoro-1-methoxybutane is CCC(F)COC.
What is the InChIKey of 2-fluoro-1-methoxybutane?
The InChIKey is WZQVIHSKEKBWSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11FO/c1-3-5(6)4-7-2/h5H,3-4H2,1-2H3.
What are the key properties of 2-fluoro-1-methoxybutane?
2-fluoro-1-methoxybutane has a molecular weight of 106.14 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-methoxybutane is sourced from PubChem (CID 12700781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).