About 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine
3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine (PubChem CID 127008837) has the molecular formula C7H12BrF2NS
and a molecular weight of 260.15 g/mol. Its IUPAC name is 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine.
Molecular Properties
| Compound Name | 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine |
| PubChem CID | 127008837 |
| Molecular Formula | C7H12BrF2NS |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine |
| SMILES | FC(F)CN1CCSCC1CBr |
| InChI | InChI=1S/C7H12BrF2NS/c8-3-6-5-12-2-1-11(6)4-7(9)10/h6-7H,1-5H2 |
| InChIKey | YPYWGKLOYYMULL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine?
The IUPAC name of 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine (CID 127008837) is 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine.
What is the SMILES notation for 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine?
The canonical SMILES for 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine is FC(F)CN1CCSCC1CBr.
What is the InChIKey of 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine?
The InChIKey is YPYWGKLOYYMULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrF2NS/c8-3-6-5-12-2-1-11(6)4-7(9)10/h6-7H,1-5H2.
What are the key properties of 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine?
3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine has a molecular weight of 260.15 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-4-(2,2-difluoroethyl)thiomorpholine is sourced from PubChem (CID 127008837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).