About 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole
5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole (PubChem CID 127008865) has the molecular formula C8H12BrN3S
and a molecular weight of 262.18 g/mol. Its IUPAC name is 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole |
| PubChem CID | 127008865 |
| Molecular Formula | C8H12BrN3S |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole |
| SMILES | CC1(C)CN(c2ncns2)CC1Br |
| InChI | InChI=1S/C8H12BrN3S/c1-8(2)4-12(3-6(8)9)7-10-5-11-13-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | PHTQPFVGLBGRSY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole?
The IUPAC name of 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole (CID 127008865) is 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole?
The canonical SMILES for 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole is CC1(C)CN(c2ncns2)CC1Br.
What is the InChIKey of 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole?
The InChIKey is PHTQPFVGLBGRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrN3S/c1-8(2)4-12(3-6(8)9)7-10-5-11-13-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole?
5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole has a molecular weight of 262.18 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromo-3,3-dimethylpyrrolidin-1-yl)-1,2,4-thiadiazole is sourced from PubChem (CID 127008865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).