C11H20FNO — CID 127009262
1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-3-fluoropropan-2-ol (PubChem CID 127009262) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is 1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-3-fluoropropan-2-ol.
| Compound Name | 1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-3-fluoropropan-2-ol |
|---|---|
| PubChem CID | 127009262 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-3-fluoropropan-2-ol |
| SMILES | OC(CF)CN1CC2CCCCC2C1 |
| InChI | InChI=1S/C11H20FNO/c12-5-11(14)8-13-6-9-3-1-2-4-10(9)7-13/h9-11,14H,1-8H2 |
| InChIKey | TWDIWOTVVBLFIL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |