About 2-iodo-N,N-dimethylethanamine;hydroiodide
2-iodo-N,N-dimethylethanamine;hydroiodide (PubChem CID 12701016) has the molecular formula C4H11I2N
and a molecular weight of 326.95 g/mol. Its IUPAC name is 2-iodo-N,N-dimethylethanamine;hydroiodide.
Molecular Properties
| Compound Name | 2-iodo-N,N-dimethylethanamine;hydroiodide |
| PubChem CID | 12701016 |
| Molecular Formula | C4H11I2N |
| Molecular Weight | 326.95 g/mol |
| Exact Mass | 326.90 |
| IUPAC Name | 2-iodo-N,N-dimethylethanamine;hydroiodide |
| SMILES | CN(C)CCI.I |
| InChI | InChI=1S/C4H10IN.HI/c1-6(2)4-3-5;/h3-4H2,1-2H3;1H |
| InChIKey | GHHBYTOZNIMUBP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.95 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-N,N-dimethylethanamine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-N,N-dimethylethanamine;hydroiodide?
The IUPAC name of 2-iodo-N,N-dimethylethanamine;hydroiodide (CID 12701016) is 2-iodo-N,N-dimethylethanamine;hydroiodide.
What is the SMILES notation for 2-iodo-N,N-dimethylethanamine;hydroiodide?
The canonical SMILES for 2-iodo-N,N-dimethylethanamine;hydroiodide is CN(C)CCI.I.
What is the InChIKey of 2-iodo-N,N-dimethylethanamine;hydroiodide?
The InChIKey is GHHBYTOZNIMUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10IN.HI/c1-6(2)4-3-5;/h3-4H2,1-2H3;1H.
What are the key properties of 2-iodo-N,N-dimethylethanamine;hydroiodide?
2-iodo-N,N-dimethylethanamine;hydroiodide has a molecular weight of 326.95 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-N,N-dimethylethanamine;hydroiodide is sourced from PubChem (CID 12701016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).