C4H6N4O2 — CID 1270103
6-(methylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 1270103) has the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. Its IUPAC name is 6-(methylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(methylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 1270103 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 6-(methylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | CNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C4H6N4O2/c1-5-2-3(9)6-4(10)8-7-2/h1H3,(H,5,7)(H2,6,8,9,10) |
| InChIKey | CCMABXFRTXZZBR-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |