About (2S)-2-amino-1,1,2-triphenylethanol
(2S)-2-amino-1,1,2-triphenylethanol (PubChem CID 1270113) has the molecular formula C20H19NO
and a molecular weight of 289.38 g/mol. Its IUPAC name is (2S)-2-amino-1,1,2-triphenylethanol.
Molecular Properties
| Compound Name | (2S)-2-amino-1,1,2-triphenylethanol |
| PubChem CID | 1270113 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (2S)-2-amino-1,1,2-triphenylethanol |
| SMILES | N[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,22H,21H2/t19-/m0/s1 |
| InChIKey | ZQNFUXDRYQQYAQ-IBGZPJMESA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-1,1,2-triphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1,1,2-triphenylethanol?
The IUPAC name of (2S)-2-amino-1,1,2-triphenylethanol (CID 1270113) is (2S)-2-amino-1,1,2-triphenylethanol.
What is the SMILES notation for (2S)-2-amino-1,1,2-triphenylethanol?
The canonical SMILES for (2S)-2-amino-1,1,2-triphenylethanol is N[C@@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-2-amino-1,1,2-triphenylethanol?
The InChIKey is ZQNFUXDRYQQYAQ-IBGZPJMESA-N. The full InChI is InChI=1S/C20H19NO/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,22H,21H2/t19-/m0/s1.
What are the key properties of (2S)-2-amino-1,1,2-triphenylethanol?
(2S)-2-amino-1,1,2-triphenylethanol has a molecular weight of 289.38 g/mol, XLogP of 3.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1,1,2-triphenylethanol is sourced from PubChem (CID 1270113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).