C20H19NO — CID 1270114
(2R)-2-amino-1,1,2-triphenylethanol (PubChem CID 1270114) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-2-amino-1,1,2-triphenylethanol.
| Compound Name | (2R)-2-amino-1,1,2-triphenylethanol |
|---|---|
| PubChem CID | 1270114 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (2R)-2-amino-1,1,2-triphenylethanol |
| SMILES | N[C@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19,22H,21H2/t19-/m1/s1 |
| InChIKey | ZQNFUXDRYQQYAQ-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |