About N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide
N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide (PubChem CID 127011776) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide.
Molecular Properties
| Compound Name | N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide |
| PubChem CID | 127011776 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide |
| SMILES | N/C(=N\C1CONC1=O)C1CCCC1 |
| InChI | InChI=1S/C9H15N3O2/c10-8(6-3-1-2-4-6)11-7-5-14-12-9(7)13/h6-7H,1-5H2,(H2,10,11)(H,12,13) |
| InChIKey | CPIHRNWTGYMBDJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide?
The IUPAC name of N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide (CID 127011776) is N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide.
What is the SMILES notation for N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide?
The canonical SMILES for N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide is N/C(=N\C1CONC1=O)C1CCCC1.
What is the InChIKey of N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide?
The InChIKey is CPIHRNWTGYMBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c10-8(6-3-1-2-4-6)11-7-5-14-12-9(7)13/h6-7H,1-5H2,(H2,10,11)(H,12,13).
What are the key properties of N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide?
N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide has a molecular weight of 197.24 g/mol, XLogP of -0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-oxo-1,2-oxazolidin-4-yl)cyclopentanecarboximidamide is sourced from PubChem (CID 127011776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).