About N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine
N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine (PubChem CID 127012019) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine |
| PubChem CID | 127012019 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine |
| SMILES | CN(CC1CC1)c1ccn(C)n1 |
| InChI | InChI=1S/C9H15N3/c1-11(7-8-3-4-8)9-5-6-12(2)10-9/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | LELQFWAIENWHOC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine?
The IUPAC name of N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine (CID 127012019) is N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine.
What is the SMILES notation for N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine?
The canonical SMILES for N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine is CN(CC1CC1)c1ccn(C)n1.
What is the InChIKey of N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine?
The InChIKey is LELQFWAIENWHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-11(7-8-3-4-8)9-5-6-12(2)10-9/h5-6,8H,3-4,7H2,1-2H3.
What are the key properties of N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine?
N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine has a molecular weight of 165.24 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N,1-dimethylpyrazol-3-amine is sourced from PubChem (CID 127012019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).