About 1-[(E)-3,3-dimethylbut-1-enyl]adamantane
1-[(E)-3,3-dimethylbut-1-enyl]adamantane (PubChem CID 12701266) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-[(E)-3,3-dimethylbut-1-enyl]adamantane.
Molecular Properties
| Compound Name | 1-[(E)-3,3-dimethylbut-1-enyl]adamantane |
| PubChem CID | 12701266 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-[(E)-3,3-dimethylbut-1-enyl]adamantane |
| SMILES | CC(C)(C)/C=C/C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26/c1-15(2,3)4-5-16-9-12-6-13(10-16)8-14(7-12)11-16/h4-5,12-14H,6-11H2,1-3H3/b5-4+ |
| InChIKey | IASTXFQNDSYAMM-SNAWJCMRSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-3,3-dimethylbut-1-enyl]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-3,3-dimethylbut-1-enyl]adamantane?
The IUPAC name of 1-[(E)-3,3-dimethylbut-1-enyl]adamantane (CID 12701266) is 1-[(E)-3,3-dimethylbut-1-enyl]adamantane.
What is the SMILES notation for 1-[(E)-3,3-dimethylbut-1-enyl]adamantane?
The canonical SMILES for 1-[(E)-3,3-dimethylbut-1-enyl]adamantane is CC(C)(C)/C=C/C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-[(E)-3,3-dimethylbut-1-enyl]adamantane?
The InChIKey is IASTXFQNDSYAMM-SNAWJCMRSA-N. The full InChI is InChI=1S/C16H26/c1-15(2,3)4-5-16-9-12-6-13(10-16)8-14(7-12)11-16/h4-5,12-14H,6-11H2,1-3H3/b5-4+.
What are the key properties of 1-[(E)-3,3-dimethylbut-1-enyl]adamantane?
1-[(E)-3,3-dimethylbut-1-enyl]adamantane has a molecular weight of 218.38 g/mol, XLogP of 4.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-3,3-dimethylbut-1-enyl]adamantane is sourced from PubChem (CID 12701266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).